A1MBD
(3~{R})-2-oxidanyl-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid
| Created: | 2025-08-08 |
| Last modified: | 2025-11-19 |
Find Related PDB Entry |
|---|
Find related ligands: |
|---|
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 33 |
| Chiral Atom Count | 1 |
| Bond Count | 34 |
| Aromatic Bond Count | 6 |
Chemical Component Summary | |
|---|---|
| Name | (3~{R})-2-oxidanyl-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| Systematic Name (OpenEye OEToolkits) | (3~{R})-2-oxidanyl-3-(propanoylamino)-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| Formula | C12 H14 B N O5 |
| Molecular Weight | 263.054 |
| Type | NON-POLYMER |
Chemical Descriptors | |||
|---|---|---|---|
| Type | Program | Version | Descriptor |
| SMILES | CACTVS | 3.385 | CCC(=O)N[CH]1Cc2cccc(C(O)=O)c2OB1O |
| SMILES | OpenEye OEToolkits | 2.0.7 | B1(C(Cc2cccc(c2O1)C(=O)O)NC(=O)CC)O |
| Canonical SMILES | CACTVS | 3.385 | CCC(=O)N[C@H]1Cc2cccc(C(O)=O)c2OB1O |
| Canonical SMILES | OpenEye OEToolkits | 2.0.7 | B1([C@H](Cc2cccc(c2O1)C(=O)O)NC(=O)CC)O |
| InChI | InChI | 1.06 | InChI=1S/C12H14BNO5/c1-2-10(15)14-9-6-7-4-3-5-8(12(16)17)11(7)19-13(9)18/h3-5,9,18H,2,6H2,1H3,(H,14,15)(H,16,17)/t9-/m0/s1 |
| InChIKey | InChI | 1.06 | QAGGLFCWUVSERJ-VIFPVBQESA-N |
Drug Info: DrugBank
DrugBank data are sourced from datasets licensed under a Creative Common's Attribution-NonCommercial 4.0 International License
| DrugBank ID | DB21457 |
|---|---|
| Name | Ledaborbactam |
| Groups | experimental |
| Description | Ledaborbactam is a small molecule drug. The usage of the INN stem '-bactam' in the name indicates that Ledaborbactam is a ẞ-lactamase inhibitor. Ledaborbactam has a monoisotopic molecular weight of 263.1 Da. |
| Synonyms | Ledaborbactam |
| CAS number | 1842397-36-7 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 138455079 |
| ChEMBL | CHEMBL5093566 |














